1,3-Adamantanediol dimethacrylate structure
|
Common Name | 1,3-Adamantanediol dimethacrylate | ||
|---|---|---|---|---|
| CAS Number | 122066-43-7 | Molecular Weight | 304.38100 | |
| Density | 1.139 g/cm3 | Boiling Point | 374.528ºC at 760 mmHg | |
| Molecular Formula | C18H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.462ºC | |
| Name | adamantane-1,3-diol,2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139 g/cm3 |
|---|---|
| Boiling Point | 374.528ºC at 760 mmHg |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.38100 |
| Flash Point | 178.462ºC |
| Exact Mass | 304.16700 |
| PSA | 52.60000 |
| LogP | 3.31640 |
| InChIKey | LWZDPKCUTBVCGX-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(OC(=O)C(=C)C)(C3)C2 |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2-Propenoic acid,2-methyl-,1,1'-tricyclo[3.3.1.13,7]decane-1,3-diyl ester |
| 1,3-Adamantanedioldimethacrylate |
| 3-(2-methylprop-2-enoyloxy)adamantanyl 2-methylprop-2-enoate |
| 2-Propenoicacid,2-methyl-,tricyclo[3.3.1.13,7]decane-1,3-diyl ester (9CI) |
| Adamantane-1,3-diyl bis(2-methylacrylate) |
| 1,3-Adamantanediol dimethacrylate |