Iris 7-WS carboxylic acid
Modify Date: 2025-09-06 12:24:21
Iris 7-WS carboxylic acid structure
|
Common Name | Iris 7-WS carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1356154-86-3 | Molecular Weight | 1000.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C53H58KN3O10S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Iris 7-WS carboxylic acid |
|---|
| Molecular Formula | C53H58KN3O10S2 |
|---|---|
| Molecular Weight | 1000.3 |
| InChIKey | YQXFZXZEZDXDBU-UHFFFAOYSA-M |
| SMILES | C#CCCCCN1C(=CC=C2CCCC(C=CC3=[N+](CCCCC#C)c4ccc(S(=O)(=O)[O-])cc4C3(C)C)=C2Oc2ccc(NC(=O)CCCC(=O)O)cc2)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21.[K+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
Novel heptamethine cyanine dyes with large Stoke's shift for biological applications in the near infrared.
J. Fluoresc. 16 , 221-225, (2006) A series of novel functionalized, water-soluble, pH-unsensitive, highly photostable heptamethine cyanine dyes (HCDs) has been synthesized. The aim of the synthesis was to obtain novel effective probes... |