Chromoionophore XIII structure
|
Common Name | Chromoionophore XIII | ||
|---|---|---|---|---|
| CAS Number | 135656-96-1 | Molecular Weight | 678.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H44ClNO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Chromoionophore XIIIChromoionophore XIII (SNARF-DE) is a pH senor that enables excitation with red light. Chromoionophore XIII functionality renders the indicator molecule lipophilic and water-insoluble but also prevents lactonization of the dye in an apolar environment[1]. |
| Name | [7-(2-decoxycarbonylphenyl)-3-hydroxybenzo[c]xanthen-10-ylidene]-diethylazanium,perchlorate |
|---|---|
| Synonym | More Synonyms |
| Description | Chromoionophore XIII (SNARF-DE) is a pH senor that enables excitation with red light. Chromoionophore XIII functionality renders the indicator molecule lipophilic and water-insoluble but also prevents lactonization of the dye in an apolar environment[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C38H44ClNO8 |
|---|---|
| Molecular Weight | 678.21100 |
| Exact Mass | 677.27600 |
| PSA | 137.18000 |
| LogP | 10.75090 |
| InChIKey | DWDBGBLRJZYBTF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1-c1c2ccc(=[N+](CC)CC)cc-2oc2c1ccc1cc(O)ccc12.[O-][Cl+3]([O-])([O-])[O-] |
| Chromoionophore XIII |
| MFCD00799316 |
| 7-[2-(Decyloxycarbonyl)-phenyl]-10-diethylamino-3-hydroxy-benzo[c]xanthylium perchlorate |