dimethyl 5,5-dimethylpyrazole-3,4-dicarboxylate structure
|
Common Name | dimethyl 5,5-dimethylpyrazole-3,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 13566-26-2 | Molecular Weight | 212.20300 | |
| Density | 1.26g/cm3 | Boiling Point | 270.7ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.7ºC | |
| Name | dimethyl 5,5-dimethylpyrazole-3,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 270.7ºC at 760 mmHg |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20300 |
| Flash Point | 112.7ºC |
| Exact Mass | 212.08000 |
| PSA | 77.32000 |
| Vapour Pressure | 0.00675mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | PJFWUHBQBYQONU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C)(C)N=N1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5-dimethyl-5H-pyrazole-3,4-dicarboxylic acid dimethyl ester |