4-(1-Sulfo-1-carboxylethyl) Edaravone structure
|
Common Name | 4-(1-Sulfo-1-carboxylethyl) Edaravone | ||
|---|---|---|---|---|
| CAS Number | 1357477-99-6 | Molecular Weight | 326.325 | |
| Density | 1.52±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1-Sulfo-1-carboxylethyl) Edaravone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52±0.1 g/cm3 |
|---|---|
| Molecular Formula | C13H14N2O6S |
| Molecular Weight | 326.325 |
| Exact Mass | 326.057251 |
| PSA | 132.72000 |
| LogP | -0.55 |
| Index of Refraction | 1.648 |
| InChIKey | QPTXNUZKOOCRLD-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1C(C)(C(=O)O)S(=O)(=O)O |
| Water Solubility | Slightly soluble (7.5 g/L) (25 ºC) |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-Methyl-5-oxo-1-phenyl-4,5-dihydro-1H-pyrazol-4-yl)-2-sulfopropanoic acid |
| 1H-Pyrazole-4-acetic acid, 4,5-dihydro-α,3-dimethyl-5-oxo-1-phenyl-α-sulfo- |
| 2-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)-2-sulfopropanoic acid |
| 4,5-Dihydro-alpha,3-dimethyl-5-oxo-1-phenyl-alpha-sulfo-1H-pyrazole-4-acetic acid |