2-methyl-4-nitrophenyl structure
|
Common Name | 2-methyl-4-nitrophenyl | ||
|---|---|---|---|---|
| CAS Number | 135805-96-8 | Molecular Weight | 194.21000 | |
| Density | 1.28 g/cm3 | Boiling Point | 354.1ºC at 760 mmHg | |
| Molecular Formula | C8H6N2O2S | Melting Point | 82ºC | |
| MSDS | N/A | Flash Point | 168ºC | |
| Name | 2-Methyl-4-nitrophenyl isothiocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28 g/cm3 |
|---|---|
| Boiling Point | 354.1ºC at 760 mmHg |
| Melting Point | 82ºC |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.21000 |
| Flash Point | 168ºC |
| Exact Mass | 194.01500 |
| PSA | 90.27000 |
| LogP | 3.16070 |
| Vapour Pressure | 7E-05mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | JEWJPETZSUMXII-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N=C=S |
| Hazard Codes | Xi: Irritant; |
|---|---|
| RIDADR | UN1759 |
| HS Code | 2930909090 |
|
~%
2-methyl-4-nitr... CAS#:135805-96-8 |
| Literature: Journal of the Chemical Society, , vol. 125, p. 1704 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-isothiocyanato-2-methyl-4-nitrobenzene |
| MFCD00060542 |