BOC-DL-(PHENYL)GLY-OH structure
|
Common Name | BOC-DL-(PHENYL)GLY-OH | ||
|---|---|---|---|---|
| CAS Number | 135807-51-1 | Molecular Weight | 251.278 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 407.2±38.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.1±26.8 °C | |
| Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.2±38.0 °C at 760 mmHg |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.278 |
| Flash Point | 200.1±26.8 °C |
| Exact Mass | 251.115753 |
| PSA | 75.63000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | FURUSGMMMFSWDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1CC(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
BOC-DL-(PHENYL)... CAS#:135807-51-1 |
| Literature: US5102667 A1, ; |
|
~%
BOC-DL-(PHENYL)... CAS#:135807-51-1 |
| Literature: Synthesis, , # 10 p. 871 - 878 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| aminophenylaceticacid |
| Benzeneacetic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| [(tert-Butoxycarbonyl)amino](phenyl)acetic acid |
| ({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)(phenyl)acetic acid |
| BOC-DL-(PHENYL)GLY-OH |