(2-Nitrophenyl)acetic acid structure
|
Common Name | (2-Nitrophenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 3740-52-1 | Molecular Weight | 181.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 345.1±17.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 137-140 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 155.9±9.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Nitrophenylacetic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.1±17.0 °C at 760 mmHg |
| Melting Point | 137-140 °C(lit.) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 155.9±9.4 °C |
| Exact Mass | 181.037506 |
| PSA | 83.12000 |
| LogP | 1.24 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | WMUZDBZPDLHUMW-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccccc1[N+](=O)[O-] |
| Storage condition | Store at RT. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R36/37/38;R68 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | AJ1130000 |
| HS Code | 29163900 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Studies on the catalytic behaviour of a cholinesterase-like abzyme in an AOT microemulsion system.
J. Biotechnol. 97(2) , 177-82, (2002) The hydrolytic activity of a monoclonal catalytic antibody (9A8) (abzyme) with acetylcholinesterase-like activity was investigated in water-in-oil (w/o) microemulsions (reverse micelles) based on sodi... |
|
|
Molecular mechanism of uncaging CO2 from nitrophenylacetate provides general guidelines for improved ortho-nitrobenzyl cages.
ChemPhysChem 12(11) , 2077-80, (2011) Femtosecond spectroscopy and quantum chemical calculations provide detailed insights into the specificities of the uncaging mechanism of CO2 from ortho-, meta-, and para-nitrophenylacetate. The emergi... |
|
|
Determination of the theophylline solubilizer salicylamide-O-acetic acid in serum and urine using high-performance liquid chromatography.
J. Pharm. Biomed. Anal. 3(5) , 469-75, (1985) A high-performance liquid chromatographic method for the determination of the theophylline solubilizer salicylamide-O-acetic acid has been developed in the range 0.5 to 10 microg/ml for human serum an... |
| MFCD00007190 |
| EINECS 223-128-0 |
| Benzeneacetic acid, 2-nitro- |
| (2-Nitrophenyl)acetic acid |
| 2-(2-nitrophenyl)acetic acid |
| 2-Nitrophenylacetic acid |