Ethanone, 1-(5,6-dihydro-3-methyl-1,4-dioxin-2-yl)-2,2,2-trifluoro- (9CI) structure
|
Common Name | Ethanone, 1-(5,6-dihydro-3-methyl-1,4-dioxin-2-yl)-2,2,2-trifluoro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 135813-43-3 | Molecular Weight | 196.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-1-(6-methyl-2,3-dihydro-1,4-dioxin-5-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7F3O3 |
|---|---|
| Molecular Weight | 196.12400 |
| Exact Mass | 196.03500 |
| PSA | 35.53000 |
| LogP | 1.39610 |
| InChIKey | SFTNDCMCHWAOIM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C(F)(F)F)OCCO1 |
|
~20%
Ethanone, 1-(5,... CAS#:135813-43-3 |
| Literature: Uniroyal Chemical Company, Inc.; Uniroyal Chemical Ltd./Ltee Patent: US5268389 A1, 1993 ; |
|
~33%
Ethanone, 1-(5,... CAS#:135813-43-3 |
| Literature: Dekeyser, Mark A.; Davis, Robert A. Journal of Agricultural and Food Chemistry, 1998 , vol. 46, # 7 p. 2827 - 2829 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Ethanone,1-(5,6-dihydro-3-methyl-1,4-dioxin-2-yl)-2,2,2-trifluoro |
| 1-(5,6-dihydro-3-methyl-1,4-dioxin-2-yl)-2,2,2-trifluoroethanone |
| Ethanone,1-(5,6-dihydro-3-methyl-1,4-dioxin-2-yl)-2,2,2-trifluoro-(9CI) |