1-Naphthalenol, 3,6,8-trimethoxy- structure
|
Common Name | 1-Naphthalenol, 3,6,8-trimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 13586-04-4 | Molecular Weight | 234.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Naphthalenol, 3,6,8-trimethoxy |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14O4 |
|---|---|
| Molecular Weight | 234.24800 |
| Exact Mass | 234.08900 |
| PSA | 47.92000 |
| LogP | 2.57120 |
| InChIKey | OMSPSCJHXZQRAT-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(OC)cc(OC)cc2c1 |
| HS Code | 2909500000 |
|---|
|
~%
1-Naphthalenol,... CAS#:13586-04-4 |
| Literature: Bycroft,B.W.; Roberts,J.C. Journal of the Chemical Society, 1963 , p. 4868 - 4872 |
|
~%
1-Naphthalenol,... CAS#:13586-04-4 |
| Literature: Bycroft,B.W.; Roberts,J.C. Journal of the Chemical Society, 1963 , p. 4868 - 4872 |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 9H-Xanthene-1,7-diacetaldehyde,8-hydroxy-2,3,6-trimethoxy-9-oxo |
| 1-Hydroxy-3,6,8-trimethoxy-naphthalin |
| 3,6,8-trimethoxy-1-naphthol |