5-hydroxy-2,7-dimethoxy-naphthalene-1,4-dione
5-hydroxy-2,7-dimethoxy-naphthalene-1,4-dione structure
|
Common Name | 5-hydroxy-2,7-dimethoxy-naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 5518-91-2 | Molecular Weight | 234.20500 | |
| Density | 1.41g/cm3 | Boiling Point | 499.3ºC at 760 mmHg | |
| Molecular Formula | C12H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 499.3ºC at 760 mmHg |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.20500 |
| Flash Point | 200.3ºC |
| Exact Mass | 234.05300 |
| PSA | 72.83000 |
| LogP | 1.31010 |
| Index of Refraction | 1.608 |
| InChIKey | XYMQOSYDJCMRBW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=O)c2c(O)cc(OC)cc2C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-hydroxy-2,7-d... CAS#:5518-91-2 |
| Literature: Baker,P.M.; Bycroft,B.W. Chemical Communications (London), 1968 , p. 71 - 72 |
|
~20%
5-hydroxy-2,7-d... CAS#:5518-91-2 |
| Literature: Savard, Jacques; Brassard, Paul Tetrahedron, 1984 , vol. 40, # 18 p. 3455 - 3464 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:2808-46-0
CAS#:479-05-0![2,5,7-TRIMETHOXY-[1,4]NAPHTHOQUINONE structure](https://image.chemsrc.com/caspic/488/5803-58-7.png)
CAS#:5803-58-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| NAPHTHOQUINONE,7-DIMETHOXY-5-HYDROXY |
| 5-Hydroxy-2,7-dimethoxy-1,4-naphthochinon |
| flaviolin-2,7-dimethyl ether |
| 2,7-Dimethoxy-5-hydroxy-1,4-naphthochinon |
| 1,2,7-dimethoxy-5-hydroxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione? |
| A: LogP of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione is 1.31010. |
| Q: What is the CAS number of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione? |
| A: CAS number of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione is 5518-91-2. |
| Q: What is the molecular weight of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione? |
| A: Molecular weight of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione is 234.20500. |
| Q: What is the SMILES notation of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione? |
| A: SMILES notation of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione is COC1=CC(=O)c2c(O)cc(OC)cc2C1=O. |
| Q: What is the Chinese name of 5518-91-2? |
| A: Chinese name of 5518-91-2 is 5518-91-2. |
| Q: What are the upstream materials of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione? |
| A: Related upstream materials(CAS) of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione: 13586-04-4;24605-23-0. |
| Q: What is the boiling point of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione? |
| A: Boiling point of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione is 499.3ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione? |
| A: Polar surface area (PSA) of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione is 72.83000. |
| Q: What are the downstream products of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione? |
| A: Related downstream products(CAS) of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione: 2808-46-0;479-05-0;5803-58-7. |
| Q: What English synonyms does 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione have? |
| A: English synonyms of 5-hydroxy-2,7-dimethoxynaphthalene-1,4-dione: NAPHTHOQUINONE,7-DIMETHOXY-5-HYDROXY, 5-Hydroxy-2,7-dimethoxy-1,4-naphthochinon, flaviolin-2,7-dimethyl ether, 2,7-Dimethoxy-5-hydroxy-1,4-naphthochinon, 1,2,7-dimethoxy-5-hydroxy. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |