erbon structure
|
Common Name | erbon | ||
|---|---|---|---|---|
| CAS Number | 136-25-4 | Molecular Weight | 366.45200 | |
| Density | 1.516g/cm3 | Boiling Point | 408.2ºC at 760mmHg | |
| Molecular Formula | C11H9Cl5O3 | Melting Point | 49-50° | |
| MSDS | N/A | Flash Point | 157.1ºC | |
| Name | erbon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 408.2ºC at 760mmHg |
| Melting Point | 49-50° |
| Molecular Formula | C11H9Cl5O3 |
| Molecular Weight | 366.45200 |
| Flash Point | 157.1ºC |
| Exact Mass | 363.89900 |
| PSA | 35.53000 |
| LogP | 4.76260 |
| Vapour Pressure | 7.12E-07mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | KMHZPJNVPCAUMN-UHFFFAOYSA-N |
| SMILES | CC(Cl)(Cl)C(=O)OCCOc1cc(Cl)c(Cl)cc1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
erbon CAS#:136-25-4 |
| Literature: Dow Chem. Co. Patent: US2754324 , 1953 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Name: qHTS assay for small molecule antagonists of farnesoid X receptor signaling
Source: NCGC
Target: farnesoid X nuclear receptor [Homo sapiens]
External Id: FXRN10
|
|
Name: qHTS assay for small molecule agonists of farnesoid X receptor signaling
Source: NCGC
Target: farnesoid X nuclear receptor [Homo sapiens]
External Id: FXRA10
|
|
Name: qHTS assay for small molecule agonists of the antioxidant response element (ARE) sign...
Source: NCGC
Target: N/A
External Id: ARE853
|
|
Name: qHTS assay for small molecule agonists of retinoid X receptor alpha signaling
Source: NCGC
Target: retinoid X nuclear receptor alpha [Homo sapiens]
External Id: RXRA10
|
|
Name: qHTS assay for small molecule agonists of thyroid hormone receptor beta signaling
Source: NCGC
Target: thyroid hormone receptor beta [Homo sapiens]
External Id: TRBA10
|
|
Name: qHTS assay for small molecule antagonists of estrogen receptor alpha signaling
Source: NCGC
Target: estrogen nuclear receptor alpha [Homo sapiens]
External Id: ERN101
|
|
Name: qHTS assay for small molecule agonists of estrogen receptor alpha signaling
Source: NCGC
Target: estrogen nuclear receptor alpha [Homo sapiens]
External Id: ERA101
|
|
Name: qHTS assay for small molecule antagonists of retinoid X receptor alpha signaling
Source: NCGC
Target: retinoid X nuclear receptor alpha [Homo sapiens]
External Id: RXRN10
|
|
Name: qHTS assay for small molecule antagonists of thyroid hormone receptor beta signaling
Source: NCGC
Target: thyroid hormone receptor beta [Homo sapiens]
External Id: TRBN10
|
|
Name: qHTS assay for small molecule agonists of androgen receptor signaling
Source: NCGC
Target: AR protein [Homo sapiens]
External Id: ARA101
|
| Pentanate |
| ERBON |
| ERBN |
| 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate |
| 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropanoate |
| Baron |
| Novege |
| Novon |
| Caswell No. 425 |
| 2,2-dichloro-propanoic acid |