erbon structure
|
Common Name | erbon | ||
|---|---|---|---|---|
| CAS Number | 136-25-4 | Molecular Weight | 366.45200 | |
| Density | 1.516g/cm3 | Boiling Point | 408.2ºC at 760mmHg | |
| Molecular Formula | C11H9Cl5O3 | Melting Point | 49-50° | |
| MSDS | N/A | Flash Point | 157.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | erbon |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 408.2ºC at 760mmHg |
| Melting Point | 49-50° |
| Molecular Formula | C11H9Cl5O3 |
| Molecular Weight | 366.45200 |
| Flash Point | 157.1ºC |
| Exact Mass | 363.89900 |
| PSA | 35.53000 |
| LogP | 4.76260 |
| Vapour Pressure | 7.12E-07mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | KMHZPJNVPCAUMN-UHFFFAOYSA-N |
| SMILES | CC(Cl)(Cl)C(=O)OCCOc1cc(Cl)c(Cl)cc1Cl |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
erbon CAS#:136-25-4 |
| Literature: Dow Chem. Co. Patent: US2754324 , 1953 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: qHTS assay for small molecule antagonists of farnesoid X receptor signaling
Source: NCGC
Target: farnesoid X nuclear receptor [Homo sapiens]
External Id: FXRN10
|
|
Name: qHTS assay for small molecule agonists of farnesoid X receptor signaling
Source: NCGC
Target: farnesoid X nuclear receptor [Homo sapiens]
External Id: FXRA10
|
|
Name: qHTS assay for small molecule agonists of the antioxidant response element (ARE) sign...
Source: NCGC
Target: N/A
External Id: ARE853
|
|
Name: qHTS assay for small molecule agonists of retinoid X receptor alpha signaling
Source: NCGC
Target: retinoid X nuclear receptor alpha [Homo sapiens]
External Id: RXRA10
|
|
Name: qHTS assay for small molecule agonists of thyroid hormone receptor beta signaling
Source: NCGC
Target: thyroid hormone receptor beta [Homo sapiens]
External Id: TRBA10
|
|
Name: qHTS assay for small molecule antagonists of estrogen receptor alpha signaling
Source: NCGC
Target: estrogen nuclear receptor alpha [Homo sapiens]
External Id: ERN101
|
|
Name: qHTS assay for small molecule agonists of estrogen receptor alpha signaling
Source: NCGC
Target: estrogen nuclear receptor alpha [Homo sapiens]
External Id: ERA101
|
|
Name: qHTS assay for small molecule antagonists of retinoid X receptor alpha signaling
Source: NCGC
Target: retinoid X nuclear receptor alpha [Homo sapiens]
External Id: RXRN10
|
|
Name: qHTS assay for small molecule antagonists of thyroid hormone receptor beta signaling
Source: NCGC
Target: thyroid hormone receptor beta [Homo sapiens]
External Id: TRBN10
|
|
Name: qHTS assay for small molecule agonists of androgen receptor signaling
Source: NCGC
Target: AR protein [Homo sapiens]
External Id: ARA101
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pentanate |
| ERBON |
| ERBN |
| 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate |
| 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropanoate |
| Baron |
| Novege |
| Novon |
| Caswell No. 425 |
| 2,2-dichloro-propanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of erbon? |
| A: Polar surface area (PSA) of erbon is 35.53000. |
| Q: What are the upstream materials of erbon? |
| A: Related upstream materials(CAS) of erbon: 75-99-0;2122-77-2. |
| Q: What is the melting point of erbon? |
| A: Melting point of erbon is 49-50°. |
| Q: What is the molecular weight of erbon? |
| A: Molecular weight of erbon is 366.45200. |
| Q: What English synonyms does erbon have? |
| A: English synonyms of erbon: Pentanate, ERBON, ERBN, 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropionate, 2-(2,4,5-trichlorophenoxy)ethyl 2,2-dichloropropanoate, Baron, Novege, Novon, Caswell No. 425, 2,2-dichloro-propanoic acid. |
| Q: What is the SMILES notation of erbon? |
| A: SMILES notation of erbon is CC(Cl)(Cl)C(=O)OCCOc1cc(Cl)c(Cl)cc1Cl. |
| Q: What is the molecular formula of erbon? |
| A: Molecular formula of erbon is C11H9Cl5O3. |
| Q: What is the English name of erbon? |
| A: The English name of erbon is erbon. |
| Q: What is the CAS number of erbon? |
| A: CAS number of erbon is 136-25-4. |
| Q: What is the safety information for erbon? |
| A: Safety information for erbon: S61. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |