UNII:4UT7R68TMI structure
|
Common Name | UNII:4UT7R68TMI | ||
|---|---|---|---|---|
| CAS Number | 136-51-6 | Molecular Weight | 326.485 | |
| Density | N/A | Boiling Point | 228ºC at 760mmHg | |
| Molecular Formula | C16H30CaO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 116.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Calcium 2-ethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 228ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H30CaO4 |
| Molecular Weight | 326.485 |
| Flash Point | 116.6ºC |
| Exact Mass | 326.177002 |
| PSA | 52.60000 |
| LogP | 4.42060 |
| Vapour Pressure | 0.027mmHg at 25°C |
| Index of Refraction | 1.445 (20ºC) |
| InChIKey | LTPCXXMGKDQPAO-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Ca+2] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| Packaging Group | I; II; III |
| HS Code | 29159080 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| UNII:4UT7R68TMI |
| calcium,2-ethylhexanoate |
| EINECS 205-249-0 |
| 2-Ethylhexanoic acid calcium salt |
| Calcium bis(2-ethylhexanoate) |
| MFCD00014001 |
| Calcium 2-ethylhexanoate |
| Hexanoic acid, 2-ethyl-, calcium salt (2:1) |