Protokylol structure
|
Common Name | Protokylol | ||
|---|---|---|---|---|
| CAS Number | 136-70-9 | Molecular Weight | 331.36300 | |
| Density | 1.336g/cm3 | Boiling Point | 585ºC at 760 mmHg | |
| Molecular Formula | C18H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.6ºC | |
Use of ProtokylolProtokylol (Caytine; JB-251) is a beta-adrenergic receptor agonist and TRPV1 agonist. Protokylol is used as a bronchodilator[1]. |
| Name | 4-[2-[1-(1,3-benzodioxol-5-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Protokylol (Caytine; JB-251) is a beta-adrenergic receptor agonist and TRPV1 agonist. Protokylol is used as a bronchodilator[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 585ºC at 760 mmHg |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.36300 |
| Flash Point | 307.6ºC |
| Exact Mass | 331.14200 |
| PSA | 91.18000 |
| LogP | 2.47160 |
| Vapour Pressure | 1.57E-14mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | LUMAEVHDZXIGEP-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccc2c(c1)OCO2)NCC(O)c1ccc(O)c(O)c1 |
| EINECS 205-255-3 |
| JB 251 |
| protokylol |
| AN 1031 |
| Beres |