Trityl tetrakis(pentafluorophenyl)borate structure
|
Common Name | Trityl tetrakis(pentafluorophenyl)borate | ||
|---|---|---|---|---|
| CAS Number | 136040-19-2 | Molecular Weight | 922.358 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H15BF20 | Melting Point | 183 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Trityl tetrakis(pentafluorophenyl)borate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 183 °C |
|---|---|
| Molecular Formula | C43H15BF20 |
| Molecular Weight | 922.358 |
| Exact Mass | 922.094727 |
| LogP | 10.55180 |
| InChIKey | TZOSNOQHGGONMD-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | 36/37/39-26-22 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trityl tetrakis(pentafluorophenyl)borate |
| Tritylium Tetrakis(pentafluorophenyl)borate |
| Triphenylcarbenium Tetrakis(pentafluorophenyl)borate |
| Triphenylmethylium tetrakis(perfluorophenyl)borate |
| Triphenylmethylium tetrakis(pentafluorophenyl)borate(1-) |
| Trityltetra(Pentafluorophenyl)Borate |
| TriphenylMethyliuM Tetrakis(pentafluorophenyl)borate |
| MFCD03426981 |