1-Chloro-3-(triphenylphosphoranylidene)acetone structure
|
Common Name | 1-Chloro-3-(triphenylphosphoranylidene)acetone | ||
|---|---|---|---|---|
| CAS Number | 13605-66-8 | Molecular Weight | 352.794 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 503.5±52.0 °C at 760 mmHg | |
| Molecular Formula | C21H18ClOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.3±30.7 °C | |
| Name | 1-chloro-3-(triphenyl-λ5-phosphanylidene)propan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 503.5±52.0 °C at 760 mmHg |
| Molecular Formula | C21H18ClOP |
| Molecular Weight | 352.794 |
| Flash Point | 258.3±30.7 °C |
| Exact Mass | 352.078369 |
| PSA | 26.88000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | NYAMPFDYTBDISG-UHFFFAOYSA-N |
| SMILES | O=C(C=P(c1ccccc1)(c1ccccc1)c1ccccc1)CCl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2931900090 |
|
~98%
1-Chloro-3-(tri... CAS#:13605-66-8 |
| Literature: Taillier, Catherine; Hameury, Thomas; Bellosta, Veronique; Cossy, Janine Tetrahedron, 2007 , vol. 63, # 21 p. 4472 - 4490 |
|
~96%
1-Chloro-3-(tri... CAS#:13605-66-8 |
| Literature: Lanaspeze, Sebastien; Neier, Reinhard Monatshefte fur Chemie, 2005 , vol. 136, # 4 p. 597 - 607 |
|
~%
1-Chloro-3-(tri... CAS#:13605-66-8 |
| Literature: Tetrahedron, , vol. 61, # 28 p. 6871 - 6878 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1-Chloro-3-(triphenylphosphoranylidene)acetone |
| 2-Propanone, 1-chloro-3-(triphenylphosphoranylidene)- |
| 1-chloro-3-(triphenylphosphoranylidene)-2-propanone |
| 1-chloro-3-(triphenyl |
| 1-chloro-3-(triphenylphosphoranylidene)propan-2-one |
| triphenylchloroacetonylphosphorane |
| 2-Propanone,1-chloro-3-(triphenylphosphoranylidene) |
| 3-chloro-1-triphenylphosphoranylidene-2-propanone |