justiciresinol structure
|
Common Name | justiciresinol | ||
|---|---|---|---|---|
| CAS Number | 136051-41-7 | Molecular Weight | 390.42700 | |
| Density | 1.26g/cm3 | Boiling Point | 591.1ºC at 760mmHg | |
| Molecular Formula | C21H26O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.3ºC | |
| Name | 4-[[(3R,4R,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-(hydroxymethyl)oxolan-3-yl]methyl]-2,6-dimethoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 591.1ºC at 760mmHg |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.42700 |
| Flash Point | 311.3ºC |
| Exact Mass | 390.16800 |
| PSA | 97.61000 |
| LogP | 2.66230 |
| Vapour Pressure | 8.11E-15mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | LNRXVGSOOWBFAI-VFCRVFHLSA-N |
| SMILES | COc1cc(C2OCC(Cc3cc(OC)c(O)c(OC)c3)C2CO)ccc1O |
|
~%
justiciresinol CAS#:136051-41-7 |
| Literature: Rajendiran, C; Pai, B R; Subramanian, P S Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1991 , vol. 30, # 7 p. 681 - 683 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Furanmethanol,tetrahydro-4-((4-hydroxy-3,5-dimethoxyphenyl)methyl)-2-(4-hydroxy-3-methoxyphenyl)-,(2S-(2alpha,3beta,4beta)) |
| (+)-justiciresinol |
| (+)-5'-methoxylariciresinol |
| 2-(4-Hydroxy-3-methoxyphenyl)-4-((4-hydroxy-3,5-dimethoxyphenyl)methyl)-tetrahydrofuran-3-methanol |
| (+)-methoxylariciresinol |