Medioresil structure
|
Common Name | Medioresil | ||
|---|---|---|---|---|
| CAS Number | 40957-99-1 | Molecular Weight | 388.411 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 575.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H24O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.0±30.1 °C | |
Use of Medioresil(+)-Medioresinol is a furofuran type lignan with antifungal, antibacterial and lesishmanicidal activities. (+)-Medioresinol leads to intracellular ROS accumulation and mitochondria-mediated apoptotic cell death in Candida albicans. (+)-Medioresinol can reduce the cardiovascular disease risk[1][2]. |
| Name | 4-[(1S,3aR,4S,6aR)-4-(4-Hydroxy-3-methoxyphenyl)tetrahydro-1H,3H- furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Medioresinol is a furofuran type lignan with antifungal, antibacterial and lesishmanicidal activities. (+)-Medioresinol leads to intracellular ROS accumulation and mitochondria-mediated apoptotic cell death in Candida albicans. (+)-Medioresinol can reduce the cardiovascular disease risk[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.7±50.0 °C at 760 mmHg |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.411 |
| Flash Point | 302.0±30.1 °C |
| Exact Mass | 388.152191 |
| PSA | 86.61000 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | VJOBNGRIBLNUKN-BMHXQBNDSA-N |
| SMILES | COc1cc(C2OCC3C(c4cc(OC)c(O)c(OC)c4)OCC23)ccc1O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 5-methoxypinoresinol |
| 5-methoxyphenylhydrazine hydrochloride |
| 4-[(1S,3aR,4S,6aR)-4-(4-Hydroxy-3-methoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenol |
| Phenol, 2,6-dimethoxy-4-[(1S,3aR,4S,6aR)-tetrahydro-4-(4-hydroxy-3-methoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]- |
| m-methoxyphenylhydrazine hydrochloride |