5-Methoxyisolariciresinol structure
|
Common Name | 5-Methoxyisolariciresinol | ||
|---|---|---|---|---|
| CAS Number | 136082-41-2 | Molecular Weight | 390.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-Methoxyisolariciresinol(+)-8-Methoxyisolariciresinol is a lignan that can be found in Illicium simonsii[1]. |
| Name | (6R,7R,8S)-1-methoxyisolariciresinol |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-8-Methoxyisolariciresinol is a lignan that can be found in Illicium simonsii[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H26O7 |
|---|---|
| Molecular Weight | 390.43 |
| Exact Mass | 390.16800 |
| PSA | 108.61000 |
| LogP | 2.02860 |
| InChIKey | ZPRAJLPWRSLALC-SUNYJGFJSA-N |
| SMILES | COc1cc(C2c3c(cc(OC)c(O)c3OC)CC(CO)C2CO)ccc1O |
| Hazard Codes | Xi |
|---|
| (6R,7R,8S)-8-(4-Hydroxy-3-methoxy-phenyl)-6,7-bis-hydroxymethyl-1,3-dimethoxy-5,6,7,8-tetrahydro-naphthalen-2-ol |
| (+)-6-methoxyisolariciresinol |
| (+)-8-methoxyisolariciresinol |