N-(2,6-Dichloro-4-methoxyphenyl)acetamide structure
|
Common Name | N-(2,6-Dichloro-4-methoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 136099-55-3 | Molecular Weight | 234.07900 | |
| Density | 1.373g/cm3 | Boiling Point | 381.6ºC at 760 mmHg | |
| Molecular Formula | C9H9Cl2NO2 | Melting Point | 186ºC | |
| MSDS | N/A | Flash Point | 184.6ºC | |
| Name | N-(2,6-Dichloro-4-methoxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 381.6ºC at 760 mmHg |
| Melting Point | 186ºC |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.07900 |
| Flash Point | 184.6ºC |
| Exact Mass | 233.00100 |
| PSA | 38.33000 |
| LogP | 3.03340 |
| Vapour Pressure | 5E-06mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | YMDULTGLSDMTFL-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c(NC(C)=O)c(Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS563C02 |
| 2,6-Dichloro-4-methoxyacetanilide |