(S)-(+)-Dimethindene maleate structure
|
Common Name | (S)-(+)-Dimethindene maleate | ||
|---|---|---|---|---|
| CAS Number | 136152-65-3 | Molecular Weight | 408.490 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S)-(+)-Dimethindene maleate(S)-(+)-Dimethindene maleate, an enantiomer, is a potent M2-selective muscarinic receptor antagonist (pA2 = 7.86/7.74; pKi = 7.78). (S)-(+)-Dimethindene maleate shows lower affinities for the muscarinic M1 (pA2 = 6.83/6.36; pKi = 7.08), the M3 (pA2 = 6.92/6.96; pKi = 6.70) and the M4 receptors (pKi = 7.00), respectively. (S)-(+)-Dimethindene maleate also is a histamine H1 receptor antagonist (pA2 = 7.8)[1]. |
| Name | (S)-(+)-Dimethindene maleate |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-(+)-Dimethindene maleate, an enantiomer, is a potent M2-selective muscarinic receptor antagonist (pA2 = 7.86/7.74; pKi = 7.78). (S)-(+)-Dimethindene maleate shows lower affinities for the muscarinic M1 (pA2 = 6.83/6.36; pKi = 7.08), the M3 (pA2 = 6.92/6.96; pKi = 6.70) and the M4 receptors (pKi = 7.00), respectively. (S)-(+)-Dimethindene maleate also is a histamine H1 receptor antagonist (pA2 = 7.8)[1]. |
|---|---|
| Related Catalog | |
| Target |
pKi: 7.08 (M1), 7.78 (M2), 6.7(M3), 7(M4) |
| In Vitro | (S)-(+)-Dimethinden is an important regulator in the maintenance of EPS cell developmental potency[2]. Cell Viability AssayWB[2] Cell Line: EPS cells Concentration: 2 μM Incubation Time: 1 hour Result: Important regulator in the maintenance of EPS cell developmental potency. |
| In Vivo | (S)-(+)-Dimethindene maleate shows affinity profile at muscarinic M1 (NB-OK 1 cells), M2 (rat heart), M3 (rat pancreas) and M4 receptors (rat striatum), with pKis 7.08, 7.78, 6.7 and 7,respectively[1]. |
| References |
| Molecular Formula | C24H28N2O4 |
|---|---|
| Molecular Weight | 408.490 |
| Exact Mass | 408.204895 |
| InChIKey | SWECWXGUJQLXJF-HFNHQGOYSA-N |
| SMILES | CC(C1=C(CCN(C)C)Cc2ccccc21)c1ccccn1.O=C(O)C=CC(=O)O |
| N,N-Dimethyl-2-{3-[(1S)-1-(2-pyridinyl)ethyl]-1H-inden-2-yl}ethanamine (2Z)-2-butenedioate (1:1) |
| J43ZL3WTLN |
| MFCD03701358 |
| N,N-Dimethyl-2-{3-[(1S)-1-(pyridin-2-yl)ethyl]-1H-inden-2-yl}ethanamine (2Z)-but-2-enedioate (1:1) |
| 1H-Indene-2-ethanamine, N,N-dimethyl-3-[(1S)-1-(2-pyridinyl)ethyl]-, (2Z)-2-butenedioate (1:1) |
| Dimetindene maleate |
| (+)-dimethindene maleate |
| N,N-dimethyl-3-[(1S)-1-(2-pyridinyl)ethyl]-1H-indene-2-ethanamine (2Z)-2-butenedioate (1:1) |
| (S)-(+)-Dimethindene maleate |
| EINECS 222-789-2 |