Dichloro(methyl)(2-phenylpropyl)silane structure
|
Common Name | Dichloro(methyl)(2-phenylpropyl)silane | ||
|---|---|---|---|---|
| CAS Number | 13617-28-2 | Molecular Weight | 233.210 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 246.2±9.0 °C at 760 mmHg | |
| Molecular Formula | C10H14Cl2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.9±14.3 °C | |
| Name | dichloro-methyl-(2-phenylpropyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 246.2±9.0 °C at 760 mmHg |
| Molecular Formula | C10H14Cl2Si |
| Molecular Weight | 233.210 |
| Flash Point | 97.9±14.3 °C |
| Exact Mass | 232.024185 |
| LogP | 5.72 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | OVUWGCLZOZCJBA-UHFFFAOYSA-N |
| SMILES | CC(C[Si](C)(Cl)Cl)c1ccccc1 |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2987 |
| HS Code | 2931900090 |
|
~56%
Dichloro(methyl... CAS#:13617-28-2 |
| Literature: Yarosh Russian Journal of General Chemistry, 2000 , vol. 70, # 10 p. 1555 - 1556 |
|
~13%
Dichloro(methyl... CAS#:13617-28-2 |
| Literature: Yoo, Bok Ryul; Hyun Kim, Jeong; Lee, Ho-Jin; Lee, Kang-Bong; Nam Jung, Il Journal of Organometallic Chemistry, 2000 , vol. 605, # 2 p. 239 - 245 |
|
~%
Dichloro(methyl... CAS#:13617-28-2 |
| Literature: Tschernyschew et al. Zhurnal Obshchei Khimii, 1958 , vol. 28, p. 2829,2830,2836;engl.Ausg.S.2853,2854,2860 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-Phenylpropylmethyldichlorsilan |
| (2-METHYL-2-PHENYLETHYL)METHYLDICHLOROSILANE |
| 2-phenyl-2-methylethyl (methyl) dichlorosilane |
| (2-Phenyl-2-methylethyl)methyldichlorosilane |
| Silane,dichloromethyl(2-phenylpropyl) |
| dichloro-methyl-(2-phenyl-propyl)-silane |
| 2-phenylpropylmethyldichlorosilane |
| Benzene, [2-(dichloromethylsilyl)-1-methylethyl]- |
| Dichloro(methyl)(2-phenylpropyl)silane |
| Dichlor-methyl-(2-phenyl-propyl)-silan |