3,3'-Dimethyl-4-(1,1'-biphenyl)amine structure
|
Common Name | 3,3'-Dimethyl-4-(1,1'-biphenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 13629-82-8 | Molecular Weight | 197.27600 | |
| Density | 1.04g/cm3 | Boiling Point | 320.5ºC at 760 mmHg | |
| Molecular Formula | C14H15N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.2ºC | |
| Name | 2-methyl-4-(3-methylphenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 320.5ºC at 760 mmHg |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.27600 |
| Flash Point | 154.2ºC |
| Exact Mass | 197.12000 |
| PSA | 26.02000 |
| LogP | 4.13380 |
| Vapour Pressure | 0.000316mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | BVXLFLQATMVEKU-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2ccc(N)c(C)c2)c1 |
| HS Code | 2921499090 |
|---|
|
~%
3,3'-Dimethyl-4... CAS#:13629-82-8 |
| Literature: Dovgosheya,M.I.; Krasovitskii,B.M. Zhurnal Organicheskoi Khimii, 1966 , vol. 2, # 7 p. 1288 - 1291,1286 - 1288 |
|
~%
3,3'-Dimethyl-4... CAS#:13629-82-8 |
| Literature: Litwinenko et al. Z.obs.Chim., 1957 , vol. 27, p. 3115,3121;engl.Ausg.S.3154,3158 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,3'-Dimethyl-4-aminobiphenyl |
| 3,3'-Dimethyl-4-biphenylamine |
| 3,3'-Dimethyl-biphenyl-4-ylamin |
| 3,3'-Dimethyl-4-aminodiphenyl |
| 3,3'-dimethyl-(1,1'-biphenyl)-4-amine |
| 4-BIPHENYLAMINE,3,3'-DIMETHYL |
| 4-Amino-3.3'-dimethyl-biphenyl |
| 3,3'-dimethyl-biphenyl-4-ylamine |