3,3'-dimethylbenzidine structure
|
Common Name | 3,3'-dimethylbenzidine | ||
|---|---|---|---|---|
| CAS Number | 119-93-7 | Molecular Weight | 212.290 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 361.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C14H16N2 | Melting Point | 128-131 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 205.1±26.0 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | c.i. 37230 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 361.0±37.0 °C at 760 mmHg |
| Melting Point | 128-131 °C(lit.) |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.290 |
| Flash Point | 205.1±26.0 °C |
| Exact Mass | 212.131348 |
| PSA | 52.04000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | NUIURNJTPRWVAP-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccc(N)c(C)c2)ccc1N |
| Water Solubility | 2% HCl: 10 mg/mL, clear |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H350-H411 |
| Precautionary Statements | P201-P273-P308 + P313 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic;N:Dangerousfortheenvironment; |
| Risk Phrases | R22;R45;R51/53;R68 |
| Safety Phrases | 53-45-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | DD1225000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 29309070 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Evidence that 4-aminobiphenyl, benzidine, and benzidine congeners produce genotoxicity through reactive oxygen species.
Environ. Mol. Mutagen. 48(5) , 404-13, (2007) 4-Aminobyphenyl (4-Ab), benzidine (Bz), and Bz congeners were evaluated for their ability to induce genotoxicity through an oxidative mechanism. The mutagenicity of these compounds was tested in the p... |
|
|
Biopartitioning micellar chromatography to predict mutagenicity of aromatic amines.
Eur. J. Med. Chem. 42 , 1396-402, (2007) Mutagenicity is a toxicity endpoint associated with the chronic exposure to chemicals. Aromatic amines have considerable industrial and environmental importance due to their widespread use in industry... |
|
|
ortho-Substituent effects on the in vitro and in vivo genotoxicity of benzidine derivatives.
Mutat. Res. 319(1) , 19-30, (1993) Benzidine and its 3,3'-diamino, 3,3'-dimethyl, 3,3'-dimethoxy, 3,3'-difluoro, 3,3'-dichloro, 3,3'-dibromo, 3,3'-dicarbomethoxy and 3,3'-dinitro derivatives together with 2-nitrobenzidine and 3-nitrobe... |
| orthotolidine |
| 3,3'-Dimethylbenzidine 4,4'-Bianisidine |
| Ellms-Hauser |
| 3,3'-Dimethyl-4,4'-biphenyldiamine |
| o-Tolidin |
| 2-Tolidina |
| 3,3'-Tolidine |
| 2-Tolidine |
| [1,1'-Biphenyl]-4,4'-diamine, 3,3'-dimethyl- |
| DMB |
| o-Tolidine (3,3'-Dimethylbenzidine) |
| diaminotolyl |
| 2-Tolidin |
| 4,4'-Diamino-3,3'-dimethylbiphenyl |
| 3,3'-dimethylbiphenyl-4,4'-diamine |
| o-Tolidine,pract |
| EINECS 204-358-0 |
| Tolidine |
| 3,3'-dimethyl-4,4'-diamino-biphenyl |
| 3,3'-dimethylbenzidine |
| MFCD00014773 |
| o-tolidine |
| 3,3'-dimethyl-[1,1'-biphenyl]-4,4'-diamine |
| bianisidine |
| ο-Tolidine |