2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester
2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester structure
|
Common Name | 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 13631-92-0 | Molecular Weight | 309.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O6 |
|---|---|
| Molecular Weight | 309.27500 |
| Exact Mass | 309.09600 |
| PSA | 122.81000 |
| LogP | 2.08510 |
| InChIKey | AXKOQCFOAAOZIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=NNc1ccccc1[N+](=O)[O-])C(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-((2-nitro-phe... CAS#:13631-92-0 |
| Literature: Kaberia, Festus; Vickery, Brian; Willey, Gerald R.; Drew, Michael G. B. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 1622 - 1626 |
|
~%
2-((2-nitro-phe... CAS#:13631-92-0 |
| Literature: Fries; Gueterbock; Kuehn Justus Liebigs Annalen der Chemie, 1934 , vol. 511, p. 213,240 |
|
~%
2-((2-nitro-phe... CAS#:13631-92-0 |
| Literature: Prasad, Durgeshwari; Prasad, Nagendra; Prasad, Radha M.; Ferrier, Robert J.; Milgate, Stephen M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 7 p. 1397 - 1399 |
|
~%
2-((2-nitro-phe... CAS#:13631-92-0 |
| Literature: Barber,H.J. et al. Journal of the Chemical Society, 1961 , p. 2828 - 2843 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| DIETHYL KETOMALONATE,2-NITROPHENYLHYDRAZONE |
| Propanedioic acid, [(2-nitrophenyl)hydrazono]-, diethyl ester (en) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: LogP of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester is 2.08510. |
| Q: What is the molecular weight of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: Molecular weight of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester is 309.27500. |
| Q: What is the molecular formula of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: Molecular formula of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester is C13H15N3O6. |
| Q: What is the CAS number of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: CAS number of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester is 13631-92-0. |
| Q: What is the SMILES notation of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: SMILES notation of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester is CCOC(=O)C(=NNc1ccccc1[N+](=O)[O-])C(=O)OCC. |
| Q: What is the English name of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: The English name of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester is 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester. |
| Q: What is the polar surface area (PSA) of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: Polar surface area (PSA) of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester is 122.81000. |
| Q: What is the InChIKey of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: InChIKey of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester is AXKOQCFOAAOZIU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 13631-92-0? |
| A: Chinese name of 13631-92-0 is 13631-92-0. |
| Q: What are the upstream materials of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester? |
| A: Related upstream materials(CAS) of 2-((2-nitro-phenyl)-hydrazono)-malonic acid diethyl ester: 119-66-4;105-53-3;25910-37-6;88-74-4;14527-90-3. |