diethyl 2-[(4-methylphenyl)hydrazinylidene]propanedioate structure
|
Common Name | diethyl 2-[(4-methylphenyl)hydrazinylidene]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 13632-06-9 | Molecular Weight | 278.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-[(4-methylphenyl)hydrazinylidene]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18N2O4 |
|---|---|
| Molecular Weight | 278.30400 |
| Exact Mass | 278.12700 |
| PSA | 76.99000 |
| LogP | 1.96210 |
| InChIKey | DZBIJOKFHYIFCK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=NNc1ccc(C)cc1)C(=O)OCC |
|
~%
diethyl 2-[(4-m... CAS#:13632-06-9 |
| Literature: Staudinger; Hammet Helvetica Chimica Acta, 1921 , vol. 4, p. 225 |
|
~%
diethyl 2-[(4-m... CAS#:13632-06-9 |
| Literature: Barber,H.J. et al. Journal of the Chemical Society, 1961 , p. 2828 - 2843 |
| T0501-9813 |
| p-Tolylhydrazono-malonsaeure-diaethylester |
| Diethylmesoxalat-p-tolylhydrazon |
| Propanedioic acid,[(4-methylphenyl)hydrazono]-,diethyl ester |
| p-tolylhydrazono-malonic acid diethyl ester |
| p-Tolylhydrazono-mesoxalsaeure-diaethylester |
| Mesoxalsaeure-diaethylester-p-tolylhydrazon |