3-(1-METHYL-1H-BENZOIMIDAZOL-2-YL)-PROPAN-1-OL structure
|
Common Name | 3-(1-METHYL-1H-BENZOIMIDAZOL-2-YL)-PROPAN-1-OL | ||
|---|---|---|---|---|
| CAS Number | 13632-08-1 | Molecular Weight | 261.72500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-acetamido-2,5-dimethylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12ClNO3S |
|---|---|
| Molecular Weight | 261.72500 |
| Exact Mass | 261.02300 |
| PSA | 75.11000 |
| LogP | 3.91960 |
| InChIKey | JHXCPQSHKJZIOG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(C)c(S(=O)(=O)Cl)cc1C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~%
3-(1-METHYL-1H-... CAS#:13632-08-1 |
| Literature: Journal of the Chemical Society, , vol. 123, p. 2386 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetylamino-2,5-dimethyl-benzolsulfonylchlorid |
| 5-Acetamino-p-xylol-sulfonsaeure-(2)-chlorid |
| 4-Acetylamino-2,5-dimethylbenzenesulfonyl chloride |
| 4-Acetamino-2,5-dimethyl-benzolsulfochlorid |