TMIO structure
|
Common Name | TMIO | ||
|---|---|---|---|---|
| CAS Number | 136440-22-7 | Molecular Weight | 126.15600 | |
| Density | 1.1192 (rough estimate) | Boiling Point | 234.28°C (rough estimate) | |
| Molecular Formula | C6H10N2O | Melting Point | 32-36ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4-trimethyl-1-oxidoimidazol-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1192 (rough estimate) |
|---|---|
| Boiling Point | 234.28°C (rough estimate) |
| Melting Point | 32-36ºC(lit.) |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.15600 |
| Exact Mass | 126.07900 |
| PSA | 41.11000 |
| LogP | 0.17250 |
| Index of Refraction | 1.5010 (estimate) |
| InChIKey | CNIGTNPXWSLRPH-UHFFFAOYSA-N |
| SMILES | CC1=NC(C)(C)[N+]([O-])=C1 |
| Storage condition | −20°C |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AmbscL02/026-L09/041C |
| 2,2,4-trimethyl-H-imidazole 1-oxide |
| MFCD00168351 |
| TMIO |
| 2,2,4-trimethyl-2H-imidazole-1-oxide |