2-methyl-2-nonyl-1-oxido-4-phenylimidazol-1-ium structure
|
Common Name | 2-methyl-2-nonyl-1-oxido-4-phenylimidazol-1-ium | ||
|---|---|---|---|---|
| CAS Number | 136440-26-1 | Molecular Weight | 300.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H28N2O | Melting Point | 43-46ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-2-nonyl-1-oxido-4-phenylimidazol-1-ium |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 43-46ºC |
|---|---|
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.43800 |
| Exact Mass | 300.22000 |
| PSA | 41.11000 |
| LogP | 4.32170 |
| InChIKey | OXPFBRNOQXIEFB-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC1(C)N=C(c2ccccc2)C=[N+]1[O-] |
|
~68%
2-methyl-2-nony... CAS#:136440-26-1 |
| Literature: Kirilyuk, I. A.; Grigor'ev, I. A.; Volodarskii, L. B. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1991 , vol. 40, # 9.2 p. 1871 - 1879 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1991 , # 9 p. 2113 - 2121 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2H-Imidazole,2-methyl-2-nonyl-4-phenyl-,1-oxide |
| 2-METHYL-2-NONYL-4-PHENYL-2H-IMIDAZOLE-1-OXIDE |