N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide structure
|
Common Name | N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide | ||
|---|---|---|---|---|
| CAS Number | 136450-06-1 | Molecular Weight | 403.470 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 528.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.2±30.1 °C | |
| Name | N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 528.0±50.0 °C at 760 mmHg |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.470 |
| Flash Point | 273.2±30.1 °C |
| Exact Mass | 403.178345 |
| PSA | 75.63000 |
| LogP | 6.62 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | NTUBQTVFDLDHRH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc(OCCCCc3ccccc3)cc2)c1O |
|
~%
N-(3-acetyl-2-h... CAS#:136450-06-1 |
| Literature: US5675036 A1, ; |
|
~%
N-(3-acetyl-2-h... CAS#:136450-06-1 |
| Literature: WO2010/2075 A1, ; Page/Page column 29 ; |
|
~68%
N-(3-acetyl-2-h... CAS#:136450-06-1 |
| Literature: SmithKline Beecham pl.c Patent: US6048983 A1, 2000 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-[4-(4-Phenylbutoxy)benzoylamino]-2'-hydroxyacetophenone |
| 1VR BQ CMVR DO4R |
| N-(3-Acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide |
| N-(3-Acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzolcarboxamid |
| Benzamide, N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)- |