chromoionophore ii structure
|
Common Name | chromoionophore ii | ||
|---|---|---|---|---|
| CAS Number | 136499-31-5 | Molecular Weight | 733.97800 | |
| Density | 1.11g/cm3 | Boiling Point | 771.9ºC at 760 mmHg | |
| Molecular Formula | C46H59N3O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 420.6ºC | |
| Name | nonan-5-yl 11-[2-[4-[[9-(dimethylamino)benzo[a]phenoxazin-5-ylidene]amino]phenyl]acetyl]oxyundecanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 771.9ºC at 760 mmHg |
| Molecular Formula | C46H59N3O5 |
| Molecular Weight | 733.97800 |
| Flash Point | 420.6ºC |
| Exact Mass | 733.44500 |
| PSA | 94.23000 |
| LogP | 11.27300 |
| Vapour Pressure | 9.51E-24mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | SWOXJPWUWJDGGP-UHFFFAOYSA-N |
| SMILES | CCCCC(CCCC)OC(=O)CCCCCCCCCCOC(=O)Cc1ccc(N=c2cc3oc4cc(N(C)C)ccc4nc-3c3ccccc23)cc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
The potentiometric pH response of chromoionophores used in optical sensors. LInder E, et.la.
J. Electroanal. Chem. 352 (1) , 309-312, (1993)
|
| Chromoionophore II |
| 9-Dimethylamino-5-[4-(16-butyl-2,14-dioxo-3,15-dioxaeicosyl)phenylimino]benzo[a]phenoxazine |
| ETH 2439 |
| MFCD00213936 |