TRK-IN-16 structure
|
Common Name | TRK-IN-16 | ||
|---|---|---|---|---|
| CAS Number | 1365212-81-2 | Molecular Weight | 353.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20FN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TRK-IN-16TRK-IN-16 is a potent inhibitor of TRK. Protein kinases play a critical role in the control of cell growth and differentiation and are responsible for the control of a wide variety of cellular signal transduction processes. TRK-IN-16 has the potential for the research of TRK-related diseases (extracted from patent WO2012034091A1, compound X-21)[1]. |
| Name | TRK-IN-16 |
|---|
| Description | TRK-IN-16 is a potent inhibitor of TRK. Protein kinases play a critical role in the control of cell growth and differentiation and are responsible for the control of a wide variety of cellular signal transduction processes. TRK-IN-16 has the potential for the research of TRK-related diseases (extracted from patent WO2012034091A1, compound X-21)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H20FN5O |
|---|---|
| Molecular Weight | 353.39 |
| InChIKey | LWGGGMIQKJKNDU-UHFFFAOYSA-N |
| SMILES | CCNC(=O)c1cnc2ccc(N3CCCC3c3cccc(F)c3)nn12 |