(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid structure
|
Common Name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 136552-06-2 | Molecular Weight | 323.343 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 543.3±43.0 °C at 760 mmHg | |
| Molecular Formula | C19H17NO4 | Melting Point | 135 °C | |
| MSDS | Chinese USA | Flash Point | 282.3±28.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (s)-n-fmoc-azetidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.3±43.0 °C at 760 mmHg |
| Melting Point | 135 °C |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.343 |
| Flash Point | 282.3±28.2 °C |
| Exact Mass | 323.115753 |
| PSA | 66.84000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | BXRZCDISGRVJCA-KRWDZBQOSA-N |
| SMILES | O=C(O)C1CCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | Store at -15°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(2S)-1-(9H-fluo... CAS#:136552-06-2 |
| Literature: US5064814 A1, ; |
|
~%
(2S)-1-(9H-fluo... CAS#:136552-06-2 |
| Literature: US5053392 A1, ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Fmoc-L-azetidine-2-carboxylic acid |
| FMOC-AZETIDINE-2-CARBOXYLIC ACID |
| MFCD01320843 |
| Fmoc-(2S)-azetidine-2-carboxylic acid |
| FMoc-Aze-OH |
| N-(N-(9-fluorenyl)methoxycarbonyl)-L-azetidine-2-carboxylic acid |
| Fmoc-L-azetidine-2-carboxylic acid |
| 1-FMOC-L-AZETIDINE-2-CARBOXYLIC ACID |
| 1-Fmoc-(S)-azetidine-2-carboxylic acid |
| FMOC-AZE(2)-OH |
| (S)-N-FMOC-Azetidine-2-carboxylic acid |
| RARECHEM EM WB 0078 |
| (2S)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-azetidinecarboxylic acid |
| (S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid |
| FMOC-(S)-AZETIDINE-2-CARBOXYLIC ACID |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: LogP of (s)-n-fmoc-azetidine-2-carboxylic acid is 2.74. |
| Q: What is the safety information for (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: Safety information for (s)-n-fmoc-azetidine-2-carboxylic acid: S26-S36. |
| Q: What is the CAS number of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: CAS number of (s)-n-fmoc-azetidine-2-carboxylic acid is 136552-06-2. |
| Q: What is the English name of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: The English name of (s)-n-fmoc-azetidine-2-carboxylic acid is (s)-n-fmoc-azetidine-2-carboxylic acid. |
| Q: What is the boiling point of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: Boiling point of (s)-n-fmoc-azetidine-2-carboxylic acid is 543.3±43.0 °C at 760 mmHg. |
| Q: What is the molecular weight of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: Molecular weight of (s)-n-fmoc-azetidine-2-carboxylic acid is 323.343. |
| Q: What is the molecular formula of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: Molecular formula of (s)-n-fmoc-azetidine-2-carboxylic acid is C19H17NO4. |
| Q: What is the SMILES notation of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: SMILES notation of (s)-n-fmoc-azetidine-2-carboxylic acid is O=C(O)C1CCN1C(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the InChIKey of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: InChIKey of (s)-n-fmoc-azetidine-2-carboxylic acid is BXRZCDISGRVJCA-KRWDZBQOSA-N. |
| Q: What is the polar surface area (PSA) of (s)-n-fmoc-azetidine-2-carboxylic acid? |
| A: Polar surface area (PSA) of (s)-n-fmoc-azetidine-2-carboxylic acid is 66.84000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |