N-Oleoyl-L-phenylalanine structure
|
Common Name | N-Oleoyl-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 136560-78-6 | Molecular Weight | 429.64 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 610.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H43NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.0±31.5 °C | |
Use of N-Oleoyl-L-phenylalanineN-Oleoyl-L-phenylalanine is an N-acyl amide[1]. |
| Name | N-Oleoyl-L-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Description | N-Oleoyl-L-phenylalanine is an N-acyl amide[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 610.4±55.0 °C at 760 mmHg |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.64 |
| Flash Point | 323.0±31.5 °C |
| Exact Mass | 429.324280 |
| LogP | 8.76 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | UWKNPULCJWBBDD-JRUKXMRZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(Cc1ccccc1)C(=O)O |
| L-Phenylalanine, N-[(9Z)-1-oxo-9-octadecen-1-yl]- |
| N-[(9Z)-9-Octadecenoyl]-L-phenylalanine |
| N-oleoyl-L-phenylalanine |