2-[[(Z)-octadec-9-enoyl]amino]pentanedioic acid structure
|
Common Name | 2-[[(Z)-octadec-9-enoyl]amino]pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4627-61-6 | Molecular Weight | 411.57500 | |
| Density | 1.035g/cm3 | Boiling Point | 611.4ºC at 760 mmHg | |
| Molecular Formula | C23H41NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.6ºC | |
| Name | 2-[[(Z)-octadec-9-enoyl]amino]pentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.035g/cm3 |
|---|---|
| Boiling Point | 611.4ºC at 760 mmHg |
| Molecular Formula | C23H41NO5 |
| Molecular Weight | 411.57500 |
| Flash Point | 323.6ºC |
| Exact Mass | 411.29800 |
| PSA | 103.70000 |
| LogP | 5.84900 |
| Index of Refraction | 1.492 |
| InChIKey | UUFVSGRELDGPGL-QJRAZLAKSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CCC(=O)O)C(=O)O |
|
~85%
2-[[(Z)-octadec... CAS#:4627-61-6 |
| Literature: Osornio, Yazmin M.; Uebelhart, Peter; Bosshard, Silvan; Konrad, Fabian; Siegel, Jay S.; Landau, Ehud M. Journal of Organic Chemistry, 2012 , vol. 77, # 23 p. 10583 - 10595 |
|
~%
2-[[(Z)-octadec... CAS#:4627-61-6 |
| Literature: Kester Patent: US2463779 , 1947 ; |
|
~%
2-[[(Z)-octadec... CAS#:4627-61-6 |
| Literature: Osornio, Yazmin M.; Uebelhart, Peter; Bosshard, Silvan; Konrad, Fabian; Siegel, Jay S.; Landau, Ehud M. Journal of Organic Chemistry, 2012 , vol. 77, # 23 p. 10583 - 10595 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Oleoyl-L-glutaminsaeure |
| oleoyl-L-Glu(OH)-OH |
| 2,3,4,5-Piperidinetetrol,6-(hydroxymethyl) |
| N-oleoyl-L-glutamic acid |
| N-oleoylglutamic acid |
| 5-AMINO-5-DEOXY-D-GALACTOPYRANOSIDE |
| L-2-Oleoylamino-glutarsaeure |