Anemarsaponin E structure
|
Common Name | Anemarsaponin E | ||
|---|---|---|---|---|
| CAS Number | 136565-73-6 | Molecular Weight | 935.100 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1016.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C46H78O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 568.6±34.3 °C | |
Use of Anemarsaponin EAnemarsaponin E is extracted from Anemarrhena asphodeloides Bunge and has anti-inflammatory activity. |
| Name | (3β,5β,25S)-26-(β-D-Glucopyranosyloxy)-22-methoxyfurostan-3-yl 2- O-β-D-glucopyranosyl-β-D-galactopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Anemarsaponin E is extracted from Anemarrhena asphodeloides Bunge and has anti-inflammatory activity. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1016.6±65.0 °C at 760 mmHg |
| Molecular Formula | C46H78O19 |
| Molecular Weight | 935.100 |
| Flash Point | 568.6±34.3 °C |
| Exact Mass | 934.513733 |
| PSA | 296.37000 |
| LogP | 0.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | FDASUPFDHLZNSK-UHFFFAOYSA-N |
| SMILES | COC1(CCC(C)COC2OC(CO)C(O)C(O)C2O)OC2CC3C4CCC5CC(OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)CCC5(C)C4CCC3(C)C2C1C |
| Storage condition | 2-8℃ |
| timosaponin B-I |
| Anemarsaponin E |
| tilivalline |
| Tilifodiolide |
| (3β,5β,25S)-26-(β-D-Glucopyranosyloxy)-22-methoxyfurostan-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
| Naphtho(1,2-c)furan-3(1H)-one,8-(2,5-dihydro-2-oxo-3-furanyl)-1-(3-furanyl)-6,7,8,9-tetrahydro-,(1R-cis) |
| β-D-Galactopyranoside, (3β,5β,25S)-26-(β-D-glucopyranosyloxy)-22-methoxyfurostan-3-yl 2-O-β-D-glucopyranosyl- |