Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine
Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine structure
|
Common Name | Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine | ||
|---|---|---|---|---|
| CAS Number | 136802-85-2 | Molecular Weight | 336.79300 | |
| Density | N/A | Boiling Point | 451.7ºC at 760 mmHg | |
| Molecular Formula | C18H22ClO2P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 227ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 451.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H22ClO2P |
| Molecular Weight | 336.79300 |
| Flash Point | 227ºC |
| Exact Mass | 336.10500 |
| PSA | 32.05000 |
| LogP | 4.52390 |
| Vapour Pressure | 6.37E-08mmHg at 25°C |
| InChIKey | JWCZKGYRAINWJA-UHFFFAOYSA-N |
| SMILES | COc1c(C)cc(P(Cl)c2cc(C)c(OC)c(C)c2)cc1C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Safety Phrases | S26-S43-S45-S36-S37-S39 |
| RIDADR | UN3265 |
| Packaging Group | II |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Bis(3,5-dimethy... CAS#:136802-85-2 |
| Literature: Tetrahedron Asymmetry, , vol. 10, # 17 p. 3341 - 3352 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| chloro-bis(4-methoxy-3,5-dimethylphenyl)phosphane |
| MFCD01630810 |
| Chlorobis(3,5-dimethyl-4-methoxyphenyl)phosphine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: Boiling point of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine is 451.7ºC at 760 mmHg. |
| Q: What is the molecular formula of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: Molecular formula of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine is C18H22ClO2P. |
| Q: What is the safety information for bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: Safety information for bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine: S26-S43-S45-S36-S37-S39. |
| Q: What is the InChIKey of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: InChIKey of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine is JWCZKGYRAINWJA-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: Polar surface area (PSA) of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine is 32.05000. |
| Q: What is the CAS number of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: CAS number of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine is 136802-85-2. |
| Q: What is the SMILES notation of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: SMILES notation of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine is COc1c(C)cc(P(Cl)c2cc(C)c(OC)c(C)c2)cc1C. |
| Q: What is the LogP of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: LogP of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine is 4.52390. |
| Q: What English synonyms does bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine have? |
| A: English synonyms of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine: chloro-bis(4-methoxy-3,5-dimethylphenyl)phosphane, MFCD01630810, Chlorobis(3,5-dimethyl-4-methoxyphenyl)phosphine. |
| Q: What is the molecular weight of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine? |
| A: Molecular weight of bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine is 336.79300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |