2-(3-NITRO-PHENYL)-1H-IMIDAZOLE structure
|
Common Name | 2-(3-NITRO-PHENYL)-1H-IMIDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 13682-18-3 | Molecular Weight | 189.17100 | |
| Density | 1.369g/cm3 | Boiling Point | 430.5ºC at 760 mmHg | |
| Molecular Formula | C9H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | 2-(3-nitrophenyl)-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 430.5ºC at 760 mmHg |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17100 |
| Flash Point | 214.2ºC |
| Exact Mass | 189.05400 |
| PSA | 74.50000 |
| LogP | 2.50810 |
| Vapour Pressure | 3.23E-07mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | ZPWKGNWCVRBHJB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2ncc[nH]2)c1 |
| HS Code | 2933290090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD05863370 |