3-Nitrobenzonitrile structure
|
Common Name | 3-Nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 619-24-9 | Molecular Weight | 148.119 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 258.1±23.0 °C at 760 mmHg | |
| Molecular Formula | C7H4N2O2 | Melting Point | 114-117 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 109.9±22.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 258.1±23.0 °C at 760 mmHg |
| Melting Point | 114-117 °C(lit.) |
| Molecular Formula | C7H4N2O2 |
| Molecular Weight | 148.119 |
| Flash Point | 109.9±22.6 °C |
| Exact Mass | 148.027283 |
| PSA | 69.61000 |
| LogP | 1.17 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | RUSAWEHOGCWOPG-UHFFFAOYSA-N |
| SMILES | N#Cc1cccc([N+](=O)[O-])c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S24/25-S36/37 |
| RIDADR | UN 3439 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DI4900000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29269095 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Characterizing synthetic polymers and additives using new ionization methods for mass spectrometry.
Rapid Commun. Mass Spectrom. 28(11) , 1175-84, (2014) New inlet and vacuum ionization methods provide advantages of specificity, simplicity and speed for the analysis of synthetic polymers and polymer additives directly from surfaces such as fibers using... |
|
|
Improving the Sensitivity of Matrix-Assisted Ionization (MAI) Mass Spectrometry Using Ammonium Salts.
J. Am. Soc. Mass Spectrom. 26 , 1649-56, (2015) In matrix-assisted ionization (MAI), analyte incorporated in a small molecule matrix is introduced into an aperture linking atmospheric pressure with the vacuum of a mass spectrometer. Gas-phase analy... |
|
|
New ionization method for analysis on atmospheric pressure ionization mass spectrometers requiring only vacuum and matrix assistance.
Anal. Chem. 85(4) , 2005-9, (2013) Matrix assisted ionization vacuum (MAIV) is a new ionization method that does not require high voltages, a laser beam, or applied heat and depends only the proper matrix, 3-nitrobenzonitrile (3-NBN), ... |
| m-NO2(C6H4)CN |
| 3-Nitrobenzonitrile |
| m-Nitrocyanobenzene |
| EINECS 210-587-7 |
| MFCD00007194 |
| 3-CYANONITROBENZENE |
| Benzonitrile,m-nitro |
| 3-Nitrobenzolcarbonitril |
| 3-Nitrbenzonitrile |
| 3-nitro-benzonitril |
| 3-cyano-1-nitrobenzene |
| m-nitro-benzonitril |
| m-Cyanonitrobenzene |
| Benzonitrile, 3-nitro- |
| m-Nitrobenzonitrile |