cyclopropyl-(3,4-dichlorophenyl)methanone structure
|
Common Name | cyclopropyl-(3,4-dichlorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 136906-33-7 | Molecular Weight | 215.07600 | |
| Density | 1.395g/cm3 | Boiling Point | 334.1ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.8ºC | |
| Name | cyclopropyl-(3,4-dichlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.395g/cm3 |
|---|---|
| Boiling Point | 334.1ºC at 760 mmHg |
| Molecular Formula | C10H8Cl2O |
| Molecular Weight | 215.07600 |
| Flash Point | 140.8ºC |
| Exact Mass | 213.99500 |
| PSA | 17.07000 |
| LogP | 3.58610 |
| Vapour Pressure | 0.000131mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | KDVARTRUFLNVCP-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C1CC1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| cyclopropyl(3,4-dichlorophenyl)methanone |
| CYCLOPROPYL 3,4-DICHLOROPHENYL KETONE |