1-dimethylcarbamoyl-4-(2-sulfoethyl)pyridinium betaine structure
|
Common Name | 1-dimethylcarbamoyl-4-(2-sulfoethyl)pyridinium betaine | ||
|---|---|---|---|---|
| CAS Number | 136997-71-2 | Molecular Weight | 258.294 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O4S | Melting Point | 185ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-dimethylcarbamoyl-4-(2-sulfoethyl)pyridinium betaine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 185ºC |
|---|---|
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.294 |
| Exact Mass | 258.067413 |
| PSA | 89.77000 |
| LogP | 0.67230 |
| InChIKey | SJHHXGGXZKPIDE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)[n+]1ccc(CCS(=O)(=O)[O-])cc1 |
| Water Solubility | almost transparency |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[1-(dimethylcarbamoyl)pyridin-1-ium-4-yl]ethanesulfonate |
| 2-[1-(Dimethylcarbamoyl)pyridinium-4-yl]ethanesulfonate |
| 2-[1-(Dimethylcarbamoyl)-4-pyridiniumyl]ethanesulfonate |
| 1-Dimethylcarbamoyl-4-(2-sulfoethyl)pyridinium inner salt |
| MFCD00185917 |
| 1-(DiMethylcarbaMoyl)-4-(2-sulfoethyl)pyridiniuM Hydroxide Inner Salt |
| Pyridinium, 1-[(dimethylamino)carbonyl]-4-(2-sulfoethyl)-, inner salt |
| 2-[1-(Dimethylcarbamoyl)-4-pyridinio]ethylsulfonate |