Potassium 5-hydroxypentanoyltrifluoroborate structure
|
Common Name | Potassium 5-hydroxypentanoyltrifluoroborate | ||
|---|---|---|---|---|
| CAS Number | 1370291-68-1 | Molecular Weight | 208.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H9BF3KO2 | Melting Point | 123.6°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Potassium 5-hydroxypentanoyltrifluoroborate |
|---|
| Melting Point | 123.6°C |
|---|---|
| Molecular Formula | C5H9BF3KO2 |
| Molecular Weight | 208.03 |
| Appearance of Characters | powder |
| InChIKey | OLLDPQQFLCSTQN-UHFFFAOYSA-N |
| SMILES | O=C(CCCCO)[B-](F)(F)F.[K+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| RIDADR | NONH for all modes of transport |
|
Amide-forming ligation of acyltrifluoroborates and hydroxylamines in water.
Angew. Chem. Int. Ed. Engl. 51(23) , 5683-6, (2012)
|