Aptiganel structure
|
Common Name | Aptiganel | ||
|---|---|---|---|---|
| CAS Number | 137159-92-3 | Molecular Weight | 303.40100 | |
| Density | 1.08g/cm3 | Boiling Point | 490.9ºC at 760 mmHg | |
| Molecular Formula | C20H21N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.7ºC | |
Use of AptiganelAptiganel (CNS 1102 (free base)), peptide, is a noncompetitive NMDA antagonist with cerebroprotective effects. Aptiganel can be used for the research of stroke[1]. |
| Name | 1-(3-ethylphenyl)-1-methyl-2-naphthalen-1-ylguanidine |
|---|---|
| Synonym | More Synonyms |
| Description | Aptiganel (CNS 1102 (free base)), peptide, is a noncompetitive NMDA antagonist with cerebroprotective effects. Aptiganel can be used for the research of stroke[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 490.9ºC at 760 mmHg |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.40100 |
| Flash Point | 250.7ºC |
| Exact Mass | 303.17400 |
| PSA | 39.12000 |
| LogP | 5.05800 |
| Vapour Pressure | 8.81E-10mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | BFNCJMURTMZBTE-UHFFFAOYSA-N |
| SMILES | CCc1cccc(N(C)C(N)=Nc2cccc3ccccc23)c1 |
| Cns 1102 |
| Aptiganel |
| Lopac-C-4238 |