Di-tert-butyl diisopropylphosphoramidoite structure
|
Common Name | Di-tert-butyl diisopropylphosphoramidoite | ||
|---|---|---|---|---|
| CAS Number | 137348-86-8 | Molecular Weight | 277.39 | |
| Density | 0.879 | Boiling Point | 252.2±9.0 °C at 760 mmHg | |
| Molecular Formula | C14H32NO2P | Melting Point | 85-90ºC 0.2 mm Hg(lit.) | |
| MSDS | Chinese USA | Flash Point | 106.4±18.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Di-tert-butyl diisopropylphosphoramidoiteDi-tert-butyl diisopropylphosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
| Name | Di-tert-butyl N,N-diisopropylphosphoramidite |
|---|---|
| Synonym | More Synonyms |
| Description | Di-tert-butyl diisopropylphosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides. |
|---|---|
| Related Catalog |
| Density | 0.879 |
|---|---|
| Boiling Point | 252.2±9.0 °C at 760 mmHg |
| Melting Point | 85-90ºC 0.2 mm Hg(lit.) |
| Molecular Formula | C14H32NO2P |
| Molecular Weight | 277.39 |
| Flash Point | 106.4±18.7 °C |
| Exact Mass | 277.217072 |
| PSA | 35.29000 |
| LogP | 5.72 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.444 |
| InChIKey | YGFLCNPXEPDANQ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)P(OC(C)(C)C)OC(C)(C)C |
| Storage condition | −20°C |
| Stability | Moisture Sensitive |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~61%
Di-tert-butyl d... CAS#:137348-86-8 |
| Literature: US7018987 B1, ; Page/Page column 9 ; |
|
~58%
Di-tert-butyl d... CAS#:137348-86-8 |
| Literature: Helvetica Chimica Acta, , vol. 74, # 6 p. 1314 - 1328 |
|
~%
Di-tert-butyl d... CAS#:137348-86-8 |
| Literature: Phosphorus, Sulfur and Silicon and Related Elements, , vol. 164, p. 277 - 291 |
| Di-tert-butyl N,N-DiisopropylphosphoraMidite |
| Di-tert-butyl diisopropylphosphoramidoite |
| Phosphoramidous acid, N,N-bis(1-methylethyl)-, bis(1,1-dimethylethyl) ester |
| Di-tert-butoxy(diisopropylamino)phosphine |
| MFCD00153506 |
| Bis(2-methyl-2-propanyl) diisopropylphosphoramidoite |
| Di-tert-butyl diisopropylphosphoramidite |
| N-[bis[(2-methylpropan-2-yl)oxy]phosphanyl]-N-propan-2-ylpropan-2-amine |