1-phenyl(trimethylsiloxy)ethylene structure
|
Common Name | 1-phenyl(trimethylsiloxy)ethylene | ||
|---|---|---|---|---|
| CAS Number | 13735-81-4 | Molecular Weight | 192.330 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 213.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H16OSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 76.1±8.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | α-(Trimethylsilyloxy)styrene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 213.5±0.0 °C at 760 mmHg |
| Molecular Formula | C11H16OSi |
| Molecular Weight | 192.330 |
| Flash Point | 76.1±8.9 °C |
| Exact Mass | 192.097046 |
| PSA | 9.23000 |
| LogP | 4.38 |
| Vapour density | >1 (vs air) |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | AFFPCIMDERUIST-UHFFFAOYSA-N |
| SMILES | C=C(O[Si](C)(C)C)c1ccccc1 |
| Storage condition | −20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
J.K. Rasmussen
Synthesis , 91, (1977)
|
|
|
E.W. Colvin
Chem. Soc. Rev. 7 , 15, (1978)
|
|
|
I. Fleming
Chimia 34 , 265, (1980)
|
| 1-Phenyl-1-(trimethylsiloxy)ethylene |
| trimethyl(1-phenylethenoxy)silane |
| Silane, trimethyl((1-phenylethenyl)oxy)- |
| Trimethyl[(1-phenylvinyl)oxy]silane |
| 1-Phenyl-1-(trimethylsilyloxy)ethylene |
| 1-Phenyl-1-trimethylsiloxyethylene |
| MFCD00008582 |
| EINECS 237-308-1 |
| trimethyl((1-phenylvinyl)oxy)silane |
| 1-phenyl(trimethylsiloxy)ethylene |
| Benzene, [1-[(trimethylsilyl)oxy]ethenyl]- |
| 1-Phenyl-1-triMethylsilyloxyethylene |