4-(4-Oxocyclohexyl)benzoic acid structure
|
Common Name | 4-(4-Oxocyclohexyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 137465-01-1 | Molecular Weight | 218.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-Oxocyclohexyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14O3 |
|---|---|
| Molecular Weight | 218.24800 |
| Exact Mass | 218.09400 |
| PSA | 54.37000 |
| LogP | 2.61150 |
| InChIKey | CXQFXVZUJFYVHS-UHFFFAOYSA-N |
| SMILES | O=C1CCC(c2ccc(C(=O)O)cc2)CC1 |
| HS Code | 2918300090 |
|---|
|
~%
4-(4-Oxocyclohe... CAS#:137465-01-1 |
| Literature: DeGraw; Christie; Colwell; Sirotnak Journal of Medicinal Chemistry, 1992 , vol. 35, # 2 p. 320 - 324 |
|
~%
4-(4-Oxocyclohe... CAS#:137465-01-1 |
| Literature: DeGraw; Christie; Colwell; Sirotnak Journal of Medicinal Chemistry, 1992 , vol. 35, # 2 p. 320 - 324 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (p-carboxyphenyl)cyclohexane |
| 4-(4-Oxo-cyclohexyl)-benzoesaeure |
| 4-(4-oxo-cyclohexyl)-benzoic acid |