4-(4-heptoxyphenyl)benzoic acid structure
|
Common Name | 4-(4-heptoxyphenyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 59748-17-3 | Molecular Weight | 312.40300 | |
| Density | 1.076 g/cm3 | Boiling Point | 471.9ºC at 760 mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.2ºC | |
| Name | 4-(4-heptoxyphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.076 g/cm3 |
|---|---|
| Boiling Point | 471.9ºC at 760 mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40300 |
| Flash Point | 164.2ºC |
| Exact Mass | 312.17300 |
| PSA | 46.53000 |
| LogP | 5.40100 |
| InChIKey | BDDYPNQQJHNKSC-UHFFFAOYSA-N |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~90%
4-(4-heptoxyphe... CAS#:59748-17-3 |
| Literature: Marini; Domenici; Malanga; Menicagli; Veracini Tetrahedron, 2010 , vol. 66, # 19 p. 3472 - 3477 |
|
~%
4-(4-heptoxyphe... CAS#:59748-17-3 |
| Literature: Merck Patent: DE2535046 , 1977 ; Chem.Abstr., 1977 , vol. 86, # 189552 |
|
~%
4-(4-heptoxyphe... CAS#:59748-17-3 |
| Literature: Gray et al. Journal of the Chemical Society, 1955 , p. 1412,1414, 1418, 1420 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(4'-n-heptyloxyphenyl)benzoic acid |
| 4'-Heptyloxy-biphenyl-4-carbonsaeure |
| 4-(4-heptyloxyphenyl)benzoic acid |
| 4'-heptyloxy-4-biphenylcarboxylic acid |
| 4''-(n-Heptyloxy)biphenyl-4'-carbonsaeure |
| 4-n-heptyloxybiphenyl-4'-carboxylic acid |
| 4'-heptyloxy-biphenyl-4-carboxylic acid |