1-isocyanato-4-(4-isocyanatophenyl)sulfonylbenzene
Modify Date: 2025-08-26 09:17:51
1-isocyanato-4-(4-isocyanatophenyl)sulfonylbenzene structure
|
Common Name | 1-isocyanato-4-(4-isocyanatophenyl)sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 13753-52-1 | Molecular Weight | 300.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-isocyanato-4-(4-isocyanatophenyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H8N2O4S |
|---|---|
| Molecular Weight | 300.28900 |
| Exact Mass | 300.02000 |
| PSA | 101.38000 |
| LogP | 3.53480 |
| InChIKey | OHTGNRSDSAOTLT-UHFFFAOYSA-N |
| SMILES | O=C=Nc1ccc(S(=O)(=O)c2ccc(N=C=O)cc2)cc1 |
|
~%
1-isocyanato-4-... CAS#:13753-52-1 |
| Literature: Heymann; Fieser Journal of the American Chemical Society, 1945 , vol. 67, p. 1979,1985 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:24731-94-0| Benzene,1,1'-sulfonylbis[4-isocyanato |
| 4,4'-diisocyanato-diphenylsulphone |
| diphenylsulphone-4,4'-diisocyanate |
| bis-(4-isocyanato-phenyl)-sulfone |