5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one structure
|
Common Name | 5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one | ||
|---|---|---|---|---|
| CAS Number | 137571-73-4 | Molecular Weight | 210.183 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 461.5±34.0 °C at 760 mmHg | |
| Molecular Formula | C10H10O5 | Melting Point | 194.5-198.5ºC(lit.) | |
| MSDS | N/A | Flash Point | 190.1±19.2 °C | |
| Name | 5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.5±34.0 °C at 760 mmHg |
| Melting Point | 194.5-198.5ºC(lit.) |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.183 |
| Flash Point | 190.1±19.2 °C |
| Exact Mass | 210.052826 |
| PSA | 75.99000 |
| LogP | 1.42 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | SCUNOPZGRLWNEJ-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)c2c(O)cc(O)cc2O1 |
| Storage condition | 2-8°C |
|
~85%
5,7-Dihydroxy-2... CAS#:137571-73-4 |
| Literature: Martinez-Solorio, Dionicio; Belmore, Kenneth A.; Jennings, Michael P. Journal of Organic Chemistry, 2011 , vol. 76, # 10 p. 3898 - 3908 |
| 4H-1,3-Benzodioxin-4-one, 5,7-dihydroxy-2,2-dimethyl- |
| 5,7-Dihydroxy-2,2-dimethyl-4H-1,3-benzodioxin-4-one |
| 5,7-dihydroxy-2,2-dimethyl-1,3-benzodioxin-4-one |