picolinafen
picolinafen structure
|
Common Name | picolinafen | ||
|---|---|---|---|---|
| CAS Number | 137641-05-5 | Molecular Weight | 376.304 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 491.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H12F4N2O2 | Melting Point | 107.2-107.6° | |
| MSDS | Chinese USA | Flash Point | 251.0±31.5 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Summary: picolinafen, Chinese name: 氟吡酰草胺, CAS number: 137641-05-5, molecular formula: C19H12F4N2O2, molecular weight: 376.304. Its melting point is 107.2-107.6°C, boiling point is 491.5±55.0 °C, and density is 1.3±0.1 g/cm3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | picolinafen |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 491.5±55.0 °C at 760 mmHg |
| Melting Point | 107.2-107.6° |
| Molecular Formula | C19H12F4N2O2 |
| Molecular Weight | 376.304 |
| Flash Point | 251.0±31.5 °C |
| Exact Mass | 376.083496 |
| PSA | 51.22000 |
| LogP | 4.53 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | CWKFPEBMTGKLKX-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(F)cc1)c1cccc(Oc2cccc(C(F)(F)F)c2)n1 |
| Storage condition | 0-6°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H410 |
| Precautionary Statements | P273-P501 |
| Personal Protective Equipment | Eyeshields;Gloves |
| Hazard Codes | N |
| Risk Phrases | R50/53 |
| Safety Phrases | S60 |
| RIDADR | UN3077 9/PG 3 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
picolinafen CAS#:137641-05-5 |
| Literature: American Cyanamid Company Patent: EP826672 A1, 1998 ; |
|
~%
picolinafen CAS#:137641-05-5 |
| Literature: US6635766 B1, ; Page/Page column 8 ; |
|
~%
picolinafen CAS#:137641-05-5 |
| Literature: US5900484 A1, ; US5892032 A1, ; |
|
~55%
picolinafen CAS#:137641-05-5 |
| Literature: Hermange, Philippe; Lindhardt, Anders T.; Taaning, Rolf H.; Bjerglund, Klaus; Lupp, Daniel; Skrydstrup, Troels Journal of the American Chemical Society, 2011 , vol. 133, # 15 p. 6061 - 6071 |
|
~%
picolinafen CAS#:137641-05-5 |
| Literature: WO2007/51759 A1, ; Page/Page column 22 ; |
|
~%
picolinafen CAS#:137641-05-5 |
| Literature: Journal of the American Chemical Society, , vol. 133, # 15 p. 6061 - 6071 |
![2-Chloro-6-[3-(trifluoromethyl)phenoxy]pyridine structure](https://www.chemsrc.com/extcaspic/078/153564-24-0.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 11343423 |
| 4'-Fluoro-6-(α,α,α-trifluoro-m-tolyloxy)pyridine-2-carboxanilide |
| picolinafen |
| N-(4-Fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]-2-pyridinecarboxamide |
| N-(4-Fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]pyridine-2-carboxamide |
| N-(4-Fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]-2-pyridinecarboximidic acid |
| T6NJ BVMR DF& FOR CXFFF |
| UNII-VJE2EX3SNN |
| N-(4-Fluorophenyl)-6-(α,α,α-trifluoro-m-tolyloxy)picolinamide |
| N-(4-Fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]picolinamide |
| N-(p-Fluorophenyl)-6-[3-(trifluoromethyl)phenoxy]-2-pyridinecarboxamide |
| 4’-fluoro-6-(α,α,α-trifluoro-m-tolyloxy)pyridine-2-carboxanilide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of picolinafen? |
| A: Polar surface area (PSA) of picolinafen is 51.22000. |
| Q: What is the safety information for picolinafen? |
| A: Safety information for picolinafen: S60. |
| Q: What is the molecular formula of picolinafen? |
| A: Molecular formula of picolinafen is C19H12F4N2O2. |
| Q: What is the molecular weight of picolinafen? |
| A: Molecular weight of picolinafen is 376.304. |
| Q: What are the upstream materials of picolinafen? |
| A: Related upstream materials(CAS) of picolinafen: 98-17-9;371-40-4;201230-82-2;855-38-9;137640-94-9. |
| Q: What is the SMILES notation of picolinafen? |
| A: SMILES notation of picolinafen is O=C(Nc1ccc(F)cc1)c1cccc(Oc2cccc(C(F)(F)F)c2)n1. |
| Q: What are the storage conditions for picolinafen? |
| A: Storage conditions for picolinafen: 0-6°C. |
| Q: What is the InChIKey of picolinafen? |
| A: InChIKey of picolinafen is CWKFPEBMTGKLKX-UHFFFAOYSA-N. |
| Q: What is the CAS number of picolinafen? |
| A: CAS number of picolinafen is 137641-05-5. |
| Q: What is the LogP of picolinafen? |
| A: LogP of picolinafen is 4.53. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |